CymitQuimica logo

CAS 1359705-87-5

:

Azetidine, 1-[(2-bromophenyl)sulfonyl]-

Description:
Azetidine, 1-[(2-bromophenyl)sulfonyl]- is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The compound features a sulfonyl group attached to a 2-bromophenyl moiety, contributing to its unique reactivity and properties. The presence of the bromine atom enhances its electrophilic character, making it potentially useful in various chemical reactions, including nucleophilic substitutions. The sulfonyl group can also serve as a leaving group or participate in further functionalization. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its physical properties, such as solubility, melting point, and stability, would depend on the specific conditions and the presence of other functional groups. Overall, Azetidine, 1-[(2-bromophenyl)sulfonyl]- represents a versatile scaffold for further chemical exploration and potential applications in synthetic organic chemistry.
Formula:C9H10BrNO2S
InChI:InChI=1S/C9H10BrNO2S/c10-8-4-1-2-5-9(8)14(12,13)11-6-3-7-11/h1-2,4-5H,3,6-7H2
InChI key:InChIKey=BRYAESLNJAKROL-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=C(Br)C=CC=C1)N2CCC2
Synonyms:
  • 1-(2-Bromobenzenesulfonyl)azetidine
  • Azetidine, 1-[(2-bromophenyl)sulfonyl]-
  • 1-((2-Bromophenyl)sulfonyl)azetidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.