CAS 13598-36-2
:Phosphonic acid
Description:
Phosphonic acid, with the CAS number 13598-36-2, is an organophosphorus compound characterized by the presence of a phosphonic acid functional group, which features a phosphorus atom bonded to a hydroxyl group and two alkyl or aryl groups. This compound is typically a colorless to pale yellow liquid that is soluble in water and polar organic solvents. Phosphonic acid exhibits strong acidity due to the presence of the phosphonic acid group, which can donate protons in solution. It is known for its ability to form stable complexes with metal ions, making it useful in various applications, including agriculture as a herbicide and in the synthesis of phosphonates. Additionally, phosphonic acid can act as a chelating agent and is involved in biochemical processes, particularly in the metabolism of phosphorus. Its stability and reactivity make it a valuable compound in both industrial and research settings, particularly in the development of phosphonic acid derivatives for various applications.
Formula:H3O3P
InChI:InChI=1S/H3O3P/c1-4(2)3/h4H,(H2,1,2,3)
InChI key:InChIKey=ABLZXFCXXLZCGV-UHFFFAOYSA-N
SMILES:P(=O)(O)O
Synonyms:- Acide phosphonique
- Acido Fosfonico
- Dihydroxyphosphine oxide
- Phosphonsaure
- Phosphorige Saeure Ueber 10% Bis 20%
- Phosphorige Saeure Ueber 20%
- Phosphorige Saeure Ueber 5% Bis 10%
- Phosphorige Saeure Unter Und Bis 5%
- Phosphorous acid
- Phosphorus Acid, Ortho-
- phosphorus(+3) trihydride cation trihydroxide
- Phosphonic acid
- hydrogen phosphonate
- Orthophosphorous acid
- Ortho-Phosphorous acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Phosphorous acid, 97%
CAS:Phosphorus acid is used as an intermediate in the preparation of other phosphorus compounds like potassium phosphite, ammonium phosphite and calcium phosphite. It is actively involved in the preparation of phosphites like aminotris(methylenephosphonic acid) (ATMP), 1-hydroxyethane 1,1-diphosphonic a
Formula:H2O3PPurity:97%Molecular weight:80.99Phosphorous acid, 98+%
CAS:Phosphorus acid is used as an intermediate in the preparation of other phosphorus compounds like potassium phosphite, ammonium phosphite and calcium phosphite. It is actively involved in the preparation of phosphites like aminotris(methylenephosphonic acid) (ATMP), 1-hydroxyethane 1,1-diphosphonic a
Formula:H2O3PPurity:98+%Color and Shape:Flakes or crystals or crystalline powder or powder, White to pale creamMolecular weight:80.99Phosphonic acid 100 µg/mL in Acetonitrile
CAS:Controlled ProductFormula:H3O3PColor and Shape:ColourlessMolecular weight:82.00Phosphorous Acid Crystals (Phosphonic Acid) extrapure, 98%
CAS:Formula:H3PO3Purity:min.98% (on anhydrous basis)Color and Shape:White, Hygroscopic crystalline compound, Clear, ColourlessMolecular weight:82.00





