CymitQuimica logo

CAS 1359828-98-0

:

Ethyl 2,3-difluoro-4-pyridinecarboxylate

Description:
Ethyl 2,3-difluoro-4-pyridinecarboxylate is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of two fluorine atoms at the 2 and 3 positions of the pyridine ring introduces significant electronegativity, influencing the compound's reactivity and polarity. The ethyl ester functional group at the 4-position contributes to its solubility in organic solvents and potential applications in organic synthesis. This compound may exhibit interesting biological activities due to the fluorine substituents, which can enhance lipophilicity and metabolic stability. Additionally, the presence of the carboxylate group suggests potential for further chemical modifications, making it a valuable intermediate in the synthesis of pharmaceuticals or agrochemicals. Overall, Ethyl 2,3-difluoro-4-pyridinecarboxylate is notable for its unique structural features and potential utility in various chemical applications.
Formula:C8H7F2NO2
InChI:InChI=1S/C8H7F2NO2/c1-2-13-8(12)5-3-4-11-7(10)6(5)9/h3-4H,2H2,1H3
InChI key:InChIKey=AOJMSQNOPRKCOZ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(F)=C(F)N=CC1
Synonyms:
  • Ethyl 2,3-difluoro-4-pyridinecarboxylate
  • 4-Pyridinecarboxylic acid, 2,3-difluoro-, ethyl ester
Found 3 products.