CymitQuimica logo

CAS 1359829-25-6

:

4-Hydroxy-2-(hydroxymethyl)-3-methoxy-N-[2-[3-methoxy-4-(phenylmethoxy)phenyl]ethyl]benzeneacetamide

Description:
4-Hydroxy-2-(hydroxymethyl)-3-methoxy-N-[2-[3-methoxy-4-(phenylmethoxy)phenyl]ethyl]benzeneacetamide, with CAS number 1359829-25-6, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as hydroxyl (-OH), methoxy (-OCH3), and amide (-CONH-) groups. This compound is likely to exhibit solubility in polar solvents due to the presence of hydroxyl groups, while the methoxy and phenyl groups may contribute to its hydrophobic characteristics. The presence of multiple aromatic rings suggests potential for π-π stacking interactions, which could influence its biological activity and stability. Additionally, the compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features indicate potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies would be necessary to fully elucidate its properties, including its reactivity, stability, and biological effects.
Formula:C26H29NO6
InChI:InChI=1S/C26H29NO6/c1-31-24-14-18(8-11-23(24)33-17-19-6-4-3-5-7-19)12-13-27-25(30)15-20-9-10-22(29)26(32-2)21(20)16-28/h3-11,14,28-29H,12-13,15-17H2,1-2H3,(H,27,30)
InChI key:InChIKey=JYZHXVUVMJWNBM-UHFFFAOYSA-N
SMILES:C(C(NCCC1=CC(OC)=C(OCC2=CC=CC=C2)C=C1)=O)C3=C(CO)C(OC)=C(O)C=C3
Synonyms:
  • Benzeneacetamide, 4-hydroxy-2-(hydroxymethyl)-3-methoxy-N-[2-[3-methoxy-4-(phenylmethoxy)phenyl]ethyl]-
  • 4-Hydroxy-2-(hydroxymethyl)-3-methoxy-N-[2-[3-methoxy-4-(phenylmethoxy)phenyl]ethyl]benzeneacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.