CAS 135984-68-8
:3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecanal
Description:
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecanal is a perfluorinated aldehyde characterized by a long carbon chain fully substituted with fluorine atoms, which significantly alters its physical and chemical properties. This compound features a linear structure with a terminal aldehyde functional group, contributing to its reactivity and potential applications in various fields, including materials science and surface chemistry. The presence of multiple fluorine atoms imparts unique characteristics such as high hydrophobicity and low surface energy, making it useful in creating water- and oil-repellent surfaces. Additionally, the fluorinated nature of the compound enhances thermal and chemical stability, which is advantageous in harsh environments. However, the environmental impact of perfluorinated compounds is a concern, as they can persist in the environment and bioaccumulate. Overall, 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecanal exemplifies the intriguing balance between utility and environmental considerations in the use of fluorinated chemicals.
Formula:C10H3F17O
InChI:InChI=1/C10H3F17O/c11-3(12,1-2-28)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h2H,1H2
SMILES:C(C=O)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
