CAS 135989-69-4

BENZOPHENONE-2,4,5-TRICARBOXYLIC ACID

Description:

Benzophenone-2,4,5-tricarboxylic acid, with the CAS number 135989-69-4, is an organic compound characterized by its structure, which includes a benzophenone moiety with three carboxylic acid functional groups. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid groups. It is known for its applications in various fields, including as a UV filter in cosmetics and as an intermediate in organic synthesis. The presence of multiple carboxylic acid groups enhances its reactivity, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, its ability to absorb UV light makes it valuable in protecting materials from photodegradation. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, benzophenone-2,4,5-tricarboxylic acid is a versatile compound with significant utility in both industrial and research applications.

Formula: C₁₆H₁₀O₇

InChI: InChI=1/C16H10O7/c17-13(8-4-2-1-3-5-8)9-6-11(15(20)21)12(16(22)23)7-10(9)14(18)19/h1-7H,(H,18,19)(H,20,21)(H,22,23)

SMILES: c1ccc(cc1)C(=O)c1cc(c(cc1C(=O)O)C(=O)O)C(=O)O

Synonyms:

• 5-Benzoylbenzene-1,2,4-Tricarboxylic Acid

2,4,5-Tricarboxybenzophenone

CAS: 135989-69-4

2,4,5-Tricarboxybenzophenone

Purity: 98%+

Molecular weight: 314.25g/mol

Ref: 54-OR93221

Benzophenone-2,4,5-tricarboxylic Acid

CAS: 135989-69-4

Formula: C₁₆H₁₀O₇

Purity: >98.0%(T)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 314.25

Ref: 3B-B2421

2,4,5-Tricarboxybenzophenone

CAS: 135989-69-4

Purity: 98%

Molecular weight: 314.2489929

Ref: 10-F788071

Benzophenone-2,4,5-tricarboxylic Acid

CAS: 135989-69-4

Formula: C₁₆H₁₀O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 314.2464

Ref: IN-DA003O2O