CAS 135991-48-9: MCI 225
Description:MCI 225, with the CAS number 135991-48-9, is a chemical compound that belongs to the class of small molecules. It is primarily recognized for its role as a selective inhibitor of certain protein kinases, which are crucial in various cellular processes, including cell growth and division. This compound has garnered interest in the field of medicinal chemistry due to its potential therapeutic applications, particularly in oncology, where it may be used to target specific cancer pathways. MCI 225 exhibits characteristics typical of kinase inhibitors, such as the ability to modulate signaling pathways and influence cellular responses. Its chemical structure includes functional groups that facilitate binding to the active sites of target kinases, thereby inhibiting their activity. Additionally, MCI 225's pharmacokinetic properties, such as solubility and bioavailability, are essential for its efficacy in biological systems. As research continues, further studies are likely to elucidate its full potential and mechanisms of action in various disease contexts.
Formula:C17H17FN4S
InChI:InChI=1/C17H17FN4S/c1-11-10-13-15(12-4-2-3-5-14(12)18)20-17(21-16(13)23-11)22-8-6-19-7-9-22/h2-5,10,19H,6-9H2,1H3
- Synonyms:
- 4-(2-Fluorophenyl)-6-methyl-2-piperazinothieno[2,3-d]pyrimidine
- 4-(2-Fluorophenyl)-6-Methyl-2-(Piperazin-1-Yl)Thieno[2,3-D]Pyrimidine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | MCI-225 REF: TM-T8443CAS: 135991-48-9 | 99.39% | 88.00 €~1,074.00 € | Tue 18 Mar 25 |
![]() | MCI 225 REF: 3D-KFA99148CAS: 135991-48-9 | Min. 95% | To inquire | Tue 22 Apr 25 |

MCI-225
Ref: TM-T8443
1mg | 88.00 € | ||
5mg | 170.00 € | ||
10mg | 259.00 € | ||
25mg | 425.00 € | ||
50mg | 598.00 € | ||
100mg | 810.00 € | ||
200mg | 1,074.00 € |

MCI 225
Ref: 3D-KFA99148
10mg | 1,030.00 € | ||
25mg | 1,679.00 € | ||
50mg | 2,685.00 € |