CAS 135991-48-9

MCI 225

Description:

MCI 225, with the CAS number 135991-48-9, is a chemical compound that belongs to the class of small molecules. It is primarily recognized for its role as a selective inhibitor of certain protein kinases, which are crucial in various cellular processes, including cell growth and division. This compound has garnered interest in the field of medicinal chemistry due to its potential therapeutic applications, particularly in oncology, where it may be used to target specific cancer pathways. MCI 225 exhibits characteristics typical of kinase inhibitors, such as the ability to modulate signaling pathways and influence cellular responses. Its chemical structure includes functional groups that facilitate binding to the active sites of target kinases, thereby inhibiting their activity. Additionally, MCI 225's pharmacokinetic properties, such as solubility and bioavailability, are essential for its efficacy in biological systems. As research continues, further studies are likely to elucidate its full potential and mechanisms of action in various disease contexts.

Formula: C₁₇H₁₇FN₄S

InChI: InChI=1/C17H17FN4S/c1-11-10-13-15(12-4-2-3-5-14(12)18)20-17(21-16(13)23-11)22-8-6-19-7-9-22/h2-5,10,19H,6-9H2,1H3

SMILES: Cc1cc2c(c3ccccc3F)nc(nc2s1)N1CCNCC1

Synonyms:

• 4-(2-Fluorophenyl)-6-methyl-2-piperazinothieno[2,3-d]pyrimidine
• 4-(2-Fluorophenyl)-6-Methyl-2-(Piperazin-1-Yl)Thieno[2,3-D]Pyrimidine

MCI-225

CAS: 135991-48-9

MCI-225

Purity: ≥98%

Molecular weight: 328.4g/mol

Ref: 54-BUP04368

MCI-225

CAS: 135991-48-9

MCI-225 is a selective inhibitor of NA reuptake with 5-HT3 receptor antagonism.

Formula: C₁₇H₁₇FN₄S

Purity: 99.32%

Color and Shape: Solid

Molecular weight: 328.4

Ref: TM-T8443

MCI 225

CAS: 135991-48-9

MCI 225 is a drug that belongs to the class of tricyclic antidepressants. It has been shown to be an effective treatment for depression and other psychiatric disorders. MCI 225 inhibits the uptake of serotonin, norepinephrine, and dopamine into the synaptic cleft by blocking the 5-HT3 receptor. This is thought to lead to increased levels of serotonin in the brain. MCI 225 also has anti-inflammatory properties and can be used in inflammatory bowel disease as well as bowel disease. MCI 225 may also have therapeutic effects on heart diseases or cancer due to its anti-inflammatory properties. Clinical use of this drug is limited due to its low potency, but it has been found to be better tolerated than other tricyclic antidepressants with similar activity.

Formula: C₁₇H₁₇FN₄S

Purity: Min. 95%

Molecular weight: 328.4 g/mol

Ref: 3D-KFA99148