CAS 136-01-6
:Cyclohexanecarboxylic acid, sodium salt (1:1)
Description:
Cyclohexanecarboxylic acid, sodium salt (1:1), with the CAS number 136-01-6, is a sodium salt derived from cyclohexanecarboxylic acid. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the sodium ion, which enhances its hydrophilicity. It is characterized by its carboxylate functional group, which imparts acidic properties, although in its salt form, it exhibits reduced acidity compared to its parent acid. Cyclohexanecarboxylic acid, sodium salt is often used in various applications, including as a surfactant, emulsifier, or in the synthesis of other chemical compounds. Its stability and relatively low toxicity make it suitable for use in both industrial and laboratory settings. Additionally, it may exhibit mild antimicrobial properties, which can be beneficial in certain formulations. Overall, this compound is valued for its functional versatility and compatibility with a range of chemical processes.
Formula:C7H12O2·Na
InChI:InChI=1S/C7H12O2.Na/c8-7(9)6-4-2-1-3-5-6;/h6H,1-5H2,(H,8,9);
InChI key:InChIKey=LKCRBCLUAAPIPD-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCCCC1.[Na]
Synonyms:- Sodium cyclohexanecarboxylate
- Cyclohexanecarboxylic acid, sodium salt
- Cyclohexanecarboxylic acid, sodium salt (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
