CAS 13601-94-0
:2,2,3-trichloropropionamide
Description:
2,2,3-Trichloropropionamide is an organic compound characterized by its structure, which includes a propionamide backbone with three chlorine atoms substituted at the 2 and 3 positions of the carbon chain. This compound is typically a white to off-white solid and is known for its use in various chemical applications, including as an intermediate in the synthesis of other organic compounds. It exhibits properties typical of amides, such as the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of chlorine atoms enhances its reactivity and can impart specific biological activities, making it of interest in agricultural and pharmaceutical research. Additionally, 2,2,3-trichloropropionamide may pose certain environmental and health risks, necessitating careful handling and adherence to safety protocols during its use. Its chemical stability and potential for degradation in various conditions are also important considerations in its application and environmental impact assessments.
Formula:C3H4Cl3NO
InChI:InChI=1/C3H4Cl3NO/c4-1-3(5,6)2(7)8/h1H2,(H2,7,8)
InChI key:InChIKey=NAXPJDCDIPVXNE-UHFFFAOYSA-N
SMILES:C(C(N)=O)(CCl)(Cl)Cl
Synonyms:- 2,2,3-Trichloropropanamide
- 2,2,3-Trichloropropionic acid amide
- Ai3-03368
- NSC 84259
- Propanamide, 2,2,3-trichloro-
- Propionamide, 2,2,3-trichloro-
- α,α,β-Trichloropropanamide
- 2,2,3-Trichloropropionamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.