CAS 136013-81-5
:L-Ornithine, N5-[[[(3,4-dihydro-2,2,5,7,8-pentamethyl-2H-1-benzopyran-6-yl)sulfonyl]amino]iminomethyl]-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-, pentafluorophenyl ester
Description:
L-Ornithine, N5-[[[(3,4-dihydro-2,2,5,7,8-pentamethyl-2H-1-benzopyran-6-yl)sulfonyl]amino]iminomethyl]-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-, pentafluorophenyl ester, with CAS number 136013-81-5, is a complex organic compound characterized by its intricate structure that includes an ornithine backbone modified with various functional groups. This compound features a sulfonamide linkage, which is indicative of its potential biological activity, possibly as an inhibitor or modulator in biochemical pathways. The presence of a pentafluorophenyl ester suggests enhanced lipophilicity, which may influence its solubility and permeability in biological systems. Additionally, the incorporation of a benzopyran moiety may impart antioxidant properties, while the fluorenylmethoxycarbonyl (Fmoc) group is commonly used in peptide synthesis, indicating potential applications in medicinal chemistry or drug development. Overall, this compound's unique structural features suggest it may have significant utility in pharmaceutical research, particularly in the development of targeted therapies.
Formula:C41H41F5N4O7S
InChI:InChI=1S/C41H41F5N4O7S/c1-20-21(2)37(22(3)23-16-17-41(4,5)57-35(20)23)58(53,54)50-39(47)48-18-10-15-29(38(51)56-36-33(45)31(43)30(42)32(44)34(36)46)49-40(52)55-19-28-26-13-8-6-11-24(26)25-12-7-9-14-27(25)28/h6-9,11-14,28-29H,10,15-19H2,1-5H3,(H,49,52)(H3,47,48,50)/t29-/m0/s1
InChI key:InChIKey=WMUBZSPLEATQKR-LJAQVGFWSA-N
SMILES:C(OC(N[C@H](C(OC1=C(F)C(F)=C(F)C(F)=C1F)=O)CCCNC(NS(=O)(=O)C=2C(C)=C3C(=C(C)C2C)OC(C)(C)CC3)=N)=O)C4C=5C(C=6C4=CC=CC6)=CC=CC5
Synonyms:- <span class="text-smallcaps">L</span>-Ornithine, N<sup>5</sup>-[[[(3,4-dihydro-2,2,5,7,8-pentamethyl-2H-1-benzopyran-6-yl)sulfonyl]amino]iminomethyl]-N<sup>2</sup>-[(9H-fluoren-9-ylmethoxy)carbonyl]-, pentafluorophenyl ester
- Fmoc-Arg(Pmc)-Aldehyde
- Fmoc-Arginine(Pmc)-Opfp
- Fmoc-N-Omega-(2,2,5,7,8-Pentamethylchroman-6-Sulfonyl)-L-Arginine Pentafluorophenyl Ester
- NALPHA-9-Fluorenylmethoxycarbonyl-NOMEGA-(2,2,5,7,8-pentamethylchroman-6-su
- L-Ornithine, N5-[[[(3,4-dihydro-2,2,5,7,8-pentamethyl-2H-1-benzopyran-6-yl)sulfonyl]amino]iminomethyl]-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-, pentafluorophenyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Fmoc-Arg(Pmc)-OPfp
CAS:Fmoc-Arg(Pmc)-OPfp is an amino acid that belongs to the group of l-amino acids. It has a molecular weight of 121.12 g/mol and a pKa of 9.78, and it can be used in the synthesis of oligopeptides. Fmoc-Arg(Pmc)-OPfp is also a positional isomer, which means that it has the same chemical formula but different spatial arrangements within the molecule. The position for this amino acid is on the N-terminal side of an alpha carbon atom, meaning that there are two chiral centers at this position on either side of the molecule. These two chiral centers are opposite each other, so they are called enantiomers. The conformation of this amino acid is L-amino acid because its amine group faces towards the right when looking at it from below. In addition, Fmoc-Arg(Pmc)-OPfp contains one specific monFormula:C41H41F5N4O7SPurity:Min. 95%Molecular weight:828.85 g/mol
