CAS 13602-48-7

N-(Tetrahydro-2-oxo-3-furanyl)benzamide

Description:

N-(Tetrahydro-2-oxo-3-furanyl)benzamide, with the CAS number 13602-48-7, is an organic compound characterized by its unique structural features, which include a benzamide moiety and a tetrahydrofuran ring containing a carbonyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carbonyl group. The tetrahydrofuran ring contributes to its cyclic structure, which can influence its chemical reactivity and stability. Additionally, the presence of the amide functional group suggests potential for hydrogen bonding, which may affect its physical properties, including melting and boiling points. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Overall, N-(Tetrahydro-2-oxo-3-furanyl)benzamide represents a class of compounds that can be explored for various applications in pharmaceuticals and organic synthesis.

Formula: C₁₁H₁₁NO₃

InChI: InChI=1S/C11H11NO3/c13-10(8-4-2-1-3-5-8)12-9-6-7-15-11(9)14/h1-5,9H,6-7H2,(H,12,13)

InChI key: InChIKey=HUNZJKFFMPFZTC-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC=CC=C1)C2C(=O)OCC2

Synonyms:

• Benzamide, N-(tetrahydro-2-oxo-3-furanyl)-
• Butyric acid, 2-benzamido-4-hydroxy-, γ-lactone
• N-(Tetrahydro-2-oxo-3-furanyl)benzamide
• Benzamide, N-(tetrahydro-2-oxo-3-furyl)-
• Butanoic acid, 2-(benzoylamino)-4-hydroxy-, γ-lactone