CymitQuimica logo

CAS 13602-84-1

:

2,6-Dimethyl-3,4-pyridinedicarboxylic acid

Description:
2,6-Dimethyl-3,4-pyridinedicarboxylic acid, with the CAS number 13602-84-1, is an organic compound belonging to the class of pyridine derivatives. It features a pyridine ring substituted with two methyl groups at the 2 and 6 positions and two carboxylic acid groups at the 3 and 4 positions. This compound is typically a crystalline solid and is soluble in polar solvents due to the presence of the carboxylic acid groups, which can engage in hydrogen bonding. Its structure allows for potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis. The presence of multiple functional groups contributes to its reactivity, making it a versatile intermediate in various chemical reactions. Additionally, the compound may exhibit biological activity, although specific biological properties would require further investigation. Overall, 2,6-Dimethyl-3,4-pyridinedicarboxylic acid is characterized by its unique structural features and potential utility in diverse chemical applications.
Formula:C9H9NO4
InChI:InChI=1S/C9H9NO4/c1-4-3-6(8(11)12)7(9(13)14)5(2)10-4/h3H,1-2H3,(H,11,12)(H,13,14)
InChI key:InChIKey=LLSUEYTYYZRPGC-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(C(O)=O)=CC(C)=NC1C
Synonyms:
  • 3,4-Pyridinedicarboxylic acid, 2,6-dimethyl-
  • 2,6-Dimethyl-3,4-pyridinedicarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.