
CAS 13602-95-4
:Ethyl 3-hydroxy-2-methyl-4-pyridinecarboxylate
Description:
Ethyl 3-hydroxy-2-methyl-4-pyridinecarboxylate, with the CAS number 13602-95-4, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylate functional group, indicating it is an ester, specifically an ethyl ester, due to the presence of the ethyl group. The hydroxyl group (-OH) at the 3-position and the methyl group (-CH3) at the 2-position contribute to its unique chemical properties, including potential hydrogen bonding and steric effects. Ethyl 3-hydroxy-2-methyl-4-pyridinecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents and may exhibit moderate polarity due to the presence of the hydroxyl group. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and utility in synthetic chemistry.
Formula:C9H11NO3
InChI:InChI=1S/C9H11NO3/c1-3-13-9(12)7-4-5-10-6(2)8(7)11/h4-5,11H,3H2,1-2H3
InChI key:InChIKey=UZPGPZMUPDKODR-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(O)=C(C)N=CC1
Synonyms:- Isonicotinic acid, 3-hydroxy-2-methyl-, ethyl ester
- Ethyl 3-hydroxy-2-methyl-4-pyridinecarboxylate
- 4-Pyridinecarboxylic acid, 3-hydroxy-2-methyl-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.