CAS 136020-18-3
:4-amino-1-(2,3-dideoxy-beta-D-erythro-hexopyranosyl)pyrimidin-2(1H)-one
Description:
4-amino-1-(2,3-dideoxy-beta-D-erythro-hexopyranosyl)pyrimidin-2(1H)-one is a chemical compound characterized by its pyrimidine core, which is substituted with an amino group and a dideoxysugar moiety. The presence of the amino group at the 4-position of the pyrimidine ring contributes to its potential biological activity, possibly influencing interactions with enzymes or receptors. The 2,3-dideoxy-beta-D-erythro-hexopyranosyl group indicates that the compound has a sugar component that lacks hydroxyl groups at the 2 and 3 positions, which can affect its solubility and reactivity. This structural feature may also enhance its stability and bioavailability. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of antiviral or antimetabolite agents, as pyrimidine derivatives are often explored for their therapeutic properties. Overall, the unique combination of a pyrimidine base and a modified sugar unit makes this compound of interest in biochemical research and pharmaceutical development.
Formula:C10H15N3O4
InChI:InChI=1/C10H15N3O4/c11-8-3-4-13(10(16)12-8)9-2-1-6(15)7(5-14)17-9/h3-4,6-7,9,14-15H,1-2,5H2,(H2,11,12,16)/t6-,7+,9+/m0/s1
Synonyms:- 2(1H)-Pyrimidinone, 4-amino-1-(2,3-dideoxy-b-D-erythro-hexopyranosyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(2,3-Dideoxy-β-D-erythro-hexo pyranosyl)cytosine
CAS:1-(2,3-Dideoxy-β-D-erythro-hexo pyranosyl)cytosine is a useful organic compound for research related to life sciences.Formula:C10H15N3O4Color and Shape:SolidMolecular weight:241.24
