CAS 13603-64-0

1-(1-Naphthalenyl)-1,2-ethanediol

Description:

1-(1-Naphthalenyl)-1,2-ethanediol, also known as 1-naphthyl-1,2-ethanediol, is an organic compound characterized by the presence of a naphthalene ring attached to a 1,2-ethanediol moiety. This compound typically exhibits a solid state at room temperature and is known for its aromatic properties due to the naphthalene structure, which contributes to its stability and potential interactions in various chemical environments. The hydroxyl groups in the ethanediol portion provide the compound with the ability to engage in hydrogen bonding, influencing its solubility and reactivity. It may be utilized in various applications, including organic synthesis and as an intermediate in the production of other chemical compounds. The presence of both aromatic and aliphatic functional groups allows for diverse chemical behavior, making it of interest in fields such as medicinal chemistry and materials science. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₂H₁₂O₂

InChI: InChI=1S/C12H12O2/c13-8-12(14)11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12-14H,8H2

InChI key: InChIKey=DIUGLBPPQLGORR-UHFFFAOYSA-N

SMILES: C(CO)(O)C=1C2=C(C=CC1)C=CC=C2

Synonyms:

• 1,2-Ethanediol, 1-(1-naphthalenyl)-
• 1,2-Ethanediol, 1-(1-naphthyl)-
• 1-Naphthyl-1,2-ethanediol
• 1-(1-Naphthalenyl)-1,2-ethanediol
• 1-(1-Naphthyl)-1,2-ethanediol