
CAS 136030-33-6
:N-FMOC-L-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid
Description:
N-FMOC-L-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid is a chemical compound characterized by its structure, which includes a tetrahydroisoquinoline core, a carboxylic acid functional group, and a 9-fluorenylmethoxycarbonyl (FMOC) protecting group. This compound is often utilized in organic synthesis and peptide chemistry, particularly for the protection of amino acids during peptide synthesis. The FMOC group is favored for its stability under basic conditions and ease of removal under mild acidic conditions, making it a valuable tool in the synthesis of complex molecules. The presence of the tetrahydroisoquinoline moiety contributes to its potential biological activity, as isoquinoline derivatives are known for various pharmacological properties. Additionally, the compound's solubility and reactivity can be influenced by the functional groups present, which is essential for its application in synthetic pathways. Overall, N-FMOC-L-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid serves as an important intermediate in the development of bioactive compounds and pharmaceuticals.
Formula:C25H20NO4
InChI:InChI=1/C25H21NO4/c27-24(28)23-13-16-7-1-2-8-17(16)14-26(23)25(29)30-15-22-20-11-5-3-9-18(20)19-10-4-6-12-21(19)22/h1-12,22-23H,13-15H2,(H,27,28)/p-1/t23-/m0/s1
SMILES:c1ccc2CN([C@@H](Cc2c1)C(=O)[O-])C(=O)OCC1c2ccccc2c2ccccc12
Synonyms:- Fmoc-L-Tetrahydroisoquinoline-3-COOH
- Fmoc-Tic-OH
- Fmoc-L-Tic-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(S)-N-Fmoc-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C25H20NO4Purity:95%Color and Shape:PowderMolecular weight:398.44Fmoc-L-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid
CAS:Biulding block for the synthesis of peptidic inhibitors of amyloid fibril formation.Formula:C25H21NO4Purity:99.8%Color and Shape:White PowderMolecular weight:399.452,3(1H)-Isoquinolinedicarboxylic acid, 3,4-dihydro-,2-(9H-fluoren-9-ylmethyl) ester, (3S)-
CAS:Formula:C25H21NO4Purity:96%Color and Shape:SolidMolecular weight:399.4385(3S)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid, N-FMOC protected
CAS:(3S)-1,2,3,4-Tetrahydroisoquinoline-3-carboxylic acid, N-FMOC protectedFormula:C25H21NO4Purity:98%Color and Shape: white solidMolecular weight:399.43854g/molfmoc-tic-oh
CAS:Formula:C25H21NO4Purity:96%Color and Shape:Solid, CrystallineMolecular weight:399.446






