CAS 1360547-50-7
:2-[2-Oxo-2-(2-oxocyclopentyl)ethyl]-1H-isoindole-1,3(2H)-dione
Description:
2-[2-Oxo-2-(2-oxocyclopentyl)ethyl]-1H-isoindole-1,3(2H)-dione, with the CAS number 1360547-50-7, is a synthetic organic compound characterized by its complex structure, which includes an isoindole core and cyclopentyl substituents. This compound features multiple functional groups, including ketones and an isoindole moiety, contributing to its potential reactivity and biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the isoindole structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the compound may possess unique optical properties, making it of interest in materials science. As with many synthetic compounds, its stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended use. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C15H13NO4
InChI:InChI=1S/C15H13NO4/c17-12-7-3-6-11(12)13(18)8-16-14(19)9-4-1-2-5-10(9)15(16)20/h1-2,4-5,11H,3,6-8H2
InChI key:InChIKey=VNCNCYYLZRMBNY-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CC(=O)C3C(=O)CCC3)=CC=CC2
Synonyms:- 1H-Isoindole-1,3(2H)-dione, 2-[2-oxo-2-(2-oxocyclopentyl)ethyl]-
- 2-[2-Oxo-2-(2-oxocyclopentyl)ethyl]-1H-isoindole-1,3(2H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
