CymitQuimica logo

CAS 13608-55-4

:

(3-phenylisoxazol-5-yl)methanamine hydrochloride

Description:
(3-Phenylisoxazol-5-yl)methanamine hydrochloride is a chemical compound characterized by its unique isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. The presence of a phenyl group enhances its aromatic properties, potentially influencing its reactivity and interaction with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of drugs targeting specific pathways or conditions. Its molecular structure suggests potential interactions with receptors or enzymes, which could be explored in pharmacological studies. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Overall, (3-phenylisoxazol-5-yl)methanamine hydrochloride represents a compound with potential utility in research and therapeutic contexts, warranting further investigation into its properties and applications.
Formula:C10H11ClN2O
InChI:InChI=1/C10H10N2O.ClH/c11-7-9-6-10(12-13-9)8-4-2-1-3-5-8;/h1-6H,7,11H2;1H
InChI key:SBVZWCJQNGBAQG-UHFFFAOYSA-N
SMILES:c1ccc(cc1)c1cc(CN)on1.Cl
Found 4 products.