CymitQuimica logo

CAS 1360922-20-8

:

6-Bromo-2,7-dimethyl-1H-indole

Description:
6-Bromo-2,7-dimethyl-1H-indole is a chemical compound belonging to the indole family, characterized by its bicyclic structure that includes a fused benzene and pyrrole ring. The presence of bromine at the 6-position and two methyl groups at the 2 and 7 positions contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent used. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, and materials science, particularly due to the indole moiety, which is known for its biological activity. The bromine substituent can enhance the compound's reactivity, making it a useful intermediate in organic synthesis. Additionally, the methyl groups can influence the compound's steric and electronic properties, affecting its interactions in various chemical environments. As with many indole derivatives, it may also exhibit fluorescence, making it of interest in biochemical and analytical applications.
Formula:C10H10BrN
InChI:InChI=1S/C10H10BrN/c1-6-5-8-3-4-9(11)7(2)10(8)12-6/h3-5,12H,1-2H3
InChI key:InChIKey=WMDDVIQUFWQAAW-UHFFFAOYSA-N
SMILES:CC1=C2C(C=C(C)N2)=CC=C1Br
Synonyms:
  • 1H-Indole, 6-bromo-2,7-dimethyl-
  • 6-Bromo-2,7-dimethyl-1H-indole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.