CymitQuimica logo

CAS 1360934-51-5

:

methyl 2-chloro-5-(trifluoromethyl)nicotinate

Description:
Methyl 2-chloro-5-(trifluoromethyl)nicotinate is a chemical compound that belongs to the class of nicotinates, which are esters derived from nicotinic acid. This substance features a methyl ester functional group, a chlorine atom, and a trifluoromethyl group, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The chlorine atom introduces additional reactivity, potentially allowing for further chemical modifications. Methyl 2-chloro-5-(trifluoromethyl)nicotinate is typically characterized by its molecular structure, which includes a pyridine ring, and its physical properties, such as solubility in organic solvents. It may exhibit specific biological activities, which can be explored in various applications, including pharmaceuticals and agrochemicals. Safety data and handling precautions should be observed due to the presence of halogenated compounds, which can pose environmental and health risks.
Formula:C8H5ClF3NO2
InChI:InChI=1S/C8H5ClF3NO2/c1-15-7(14)5-2-4(8(10,11)12)3-13-6(5)9/h2-3H,1H3
InChI key:ABTMVRRTSDJRGO-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(N=CC(=C1)C(F)(F)F)Cl
Found 4 products.