CAS 1360965-18-9

7-Bromo-1,3-dihydro-4-methoxy-2H-indol-2-one

Description:

7-Bromo-1,3-dihydro-4-methoxy-2H-indol-2-one is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 7-position and a methoxy group at the 4-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the indole moiety's prevalence in biologically active compounds. The compound may also exhibit interesting optical properties and could be studied for its interactions in various chemical environments. As with many brominated compounds, it may possess specific reactivity patterns, including electrophilic substitution and nucleophilic attack, making it a subject of interest in synthetic organic chemistry. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.

Formula: C₉H₈BrNO₂

InChI: InChI=1S/C9H8BrNO2/c1-13-7-3-2-6(10)9-5(7)4-8(12)11-9/h2-3H,4H2,1H3,(H,11,12)

InChI key: InChIKey=UJSAPVAWPVAPIS-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(NC(=O)C2)=C(Br)C=C1

Synonyms:

• 7-Bromo-1,3-dihydro-4-methoxy-2H-indol-2-one
• 2H-Indol-2-one, 7-bromo-1,3-dihydro-4-methoxy-