CAS 136098-07-2
:ALPHA-DELTA-UA-[1->4]-GLCNAC
Description:
Alpha-delta-UA-[1->4]-GlcNAc, identified by the CAS number 136098-07-2, is a glycosylated compound that features a unique structure comprising a uronic acid (UA) linked to N-acetylglucosamine (GlcNAc) through a specific glycosidic bond. This compound is characterized by its role in biological systems, particularly in the context of polysaccharides and glycoproteins, where it may participate in various biochemical processes, including cell signaling and structural integrity of cellular components. The alpha and delta designations indicate specific stereochemical configurations that can influence the compound's reactivity and interactions with other biomolecules. Its solubility, stability, and biological activity can vary based on environmental conditions such as pH and temperature. Additionally, compounds like Alpha-delta-UA-[1->4]-GlcNAc are often studied for their potential applications in pharmaceuticals, biotechnology, and as tools in glycobiology research, given their importance in understanding cellular interactions and functions.
Formula:C14H21NNaO11
InChI:InChI=1/C14H21NO11.Na/c1-5(18)15-6(3-16)10(21)12(8(20)4-17)26-14-11(22)7(19)2-9(25-14)13(23)24;/h2-3,6-8,10-12,14,17,19-22H,4H2,1H3,(H,15,18)(H,23,24);
SMILES:CC(=NC(C=O)C(C(C(CO)O)OC1C(C(C=C(C(=O)O)O1)O)O)O)O.[Na]
Synonyms:- Heparin Disaccharide Iv-A Sodium Salt
- Disaccharide Iv-A
- Disaccharide Delta Di-Ha
- Deltaua->Glcnac Na
- Heparin Disaccharide Iv-A Sodium
- (Α-△Ua-[1→4]-Glcnac)
- hexose, 2-(acetylamino)-2-deoxy-4-O-(4-deoxyhex-4-enopyranuronosyl)-, monosodium salt
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Heparin disaccharide IV-A sodium salt
CAS:Formula:C14H20NO11NaPurity:≥ 95.0%Color and Shape:White solidMolecular weight:401.30Heparin disaccharide IV-A, sodium
CAS:<p>Heparin disaccharide IV-A, sodium (HDS) is a complex carbohydrate. It is an oligosaccharide that consists of a number of sugar molecules linked together to form a polysaccharide. HDS can be modified by methylation and glycosylation as well as fluorination and click modification. HDS has high purity and is synthetic.</p>Formula:C14H20NO11•NaPurity:Min. 95%Color and Shape:PowderMolecular weight:401.3 g/molRef: 4Z-H-026005
Discontinued product


