CymitQuimica logo

CAS 136098-14-1

:

2,7-Diazaspiro[3.5]nonane

Description:
2,7-Diazaspiro[3.5]nonane is a bicyclic organic compound characterized by its unique spiro structure, which consists of two nitrogen atoms incorporated into a nonane framework. This compound features a spiro connection between two saturated rings, contributing to its rigidity and potential for diverse chemical reactivity. The presence of nitrogen atoms in the structure can influence its basicity and potential interactions with other chemical species. Typically, compounds like 2,7-Diazaspiro[3.5]nonane may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Its molecular structure can lead to specific stereochemical configurations, which may affect its biological activity. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 2,7-Diazaspiro[3.5]nonane represents a class of compounds that can be explored for various applications in organic synthesis and drug development, although specific applications would depend on further research and characterization.
Formula:C7H14N2
InChI:InChI=1S/C7H14N2/c1-3-8-4-2-7(1)5-9-6-7/h8-9H,1-6H2
InChI key:InChIKey=DROZYMFJWSYDRY-UHFFFAOYSA-N
SMILES:C12(CNC1)CCNCC2
Synonyms:
  • 2,7-Diazaspiro[3.5]nonane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.