CAS 136099-58-6

Acetamide, 2-chloro-N-(2,6-dichloro-4-methoxyphenyl)-N-phenyl-

Description:

Acetamide, 2-chloro-N-(2,6-dichloro-4-methoxyphenyl)-N-phenyl- is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This compound features a chloro-substituted aromatic ring, specifically with two chlorine atoms and a methoxy group, contributing to its unique chemical properties. The presence of the phenyl groups enhances its hydrophobic characteristics, while the chloro and methoxy substituents can influence its reactivity and solubility in various solvents. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be affected by the electronic effects of the substituents, making it a candidate for further study in organic synthesis and medicinal chemistry. Safety data and handling precautions should be considered due to the presence of chlorine atoms, which can pose health risks.

Formula: C₁₅H₁₂Cl₃NO₂

InChI: InChI=1S/C15H12Cl3NO2/c1-21-11-7-12(17)15(13(18)8-11)19(14(20)9-16)10-5-3-2-4-6-10/h2-8H,9H2,1H3

InChI key: InChIKey=OVLSZLXVWQNDLH-UHFFFAOYSA-N

SMILES: N(C(CCl)=O)(C1=C(Cl)C=C(OC)C=C1Cl)C2=CC=CC=C2

Synonyms:

• Acetamide, 2-chloro-N-(2,6-dichloro-4-methoxyphenyl)-N-phenyl-
• 2-Chloro-N-(2,6-dichloro-4-methoxyphenyl)-N-phenylacetamide

2-Chloro-N-(2,6-dichloro-4-methoxyphenyl)-N-phenylacetamide

Controlled Product

CAS: 136099-58-6

Formula: C₁₅H₁₂Cl₃NO₂

Color and Shape: Neat

Molecular weight: 344.62

Ref: TR-C365920