CAS 1361-49-5
:Benzenepropanoic acid, β-(dimethylamino)-α-hydroxy-, (1S,2R,3E,5S,7S,8S,10R,13S)-2,13-bis(acetyloxy)-7,10-dihydroxy-8,12,15,15-tetramethyl-9-oxotricyclo[9.3.1.14,8]hexadeca-3,11-dien-5-yl ester, (αR,βS)-
Description:
Benzenepropanoic acid, β-(dimethylamino)-α-hydroxy-, with the CAS number 1361-49-5, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as hydroxyl (-OH), acetyloxy (-OCOCH3), and a dimethylamino group. This compound features a tricyclic framework, indicative of its potential biological activity, and is known for its stereochemistry, which is specified by the (1S,2R,3E,5S,7S,8S,10R,13S) configuration. The presence of multiple methyl groups contributes to its hydrophobic characteristics, while the hydroxyl groups enhance its solubility in polar solvents. The compound's ester functionality suggests it may undergo hydrolysis, making it relevant in various chemical reactions. Its structural complexity and specific stereochemistry may influence its interactions in biological systems, potentially leading to pharmacological applications. Overall, this compound exemplifies the diverse nature of organic molecules and their potential utility in medicinal chemistry and related fields.
Formula:C35H47NO10
InChI:InChI=1/C35H47NO10/c1-18-24(44-19(2)37)15-23-26(45-20(3)38)14-22-17-35(6,32(42)30(40)28(18)34(23,4)5)27(39)16-25(22)46-33(43)31(41)29(36(7)8)21-12-10-9-11-13-21/h9-14,23-27,29-31,39-41H,15-17H2,1-8H3/b22-14+/t23-,24-,25-,26-,27-,29-,30+,31+,35-/m0/s1
InChI key:InChIKey=KOTXAHKUCAQPQA-MCBQMXOVSA-N
SMILES:O(C([C@@H]([C@@H](N(C)C)C1=CC=CC=C1)O)=O)[C@@H]2/C/3=C/[C@H](OC(C)=O)[C@]4(C(C)(C)C([C@@H](O)C(=O)[C@@](C)(C3)[C@@H](O)C2)=C(C)[C@@H](OC(C)=O)C4)[H]
Synonyms:- Tricyclo[9.3.1.14,8]hexadecane, benzenepropanoic acid deriv.
- Taxin A
- Benzenepropanoic acid, β-(dimethylamino)-α-hydroxy-, 2,13-bis(acetyloxy)-7,10-dihydroxy-8,12,15,15-tetramethyl-9-oxotricyclo[9.3.1.14,8]hexadeca-3,11-dien-5-yl ester, [1S-[1R*,2S*,3E,5R*(αS*,βR*),7R*,8R*,10S*,13R*]]-
- Benzenepropanoic acid, β-(dimethylamino)-α-hydroxy-, (1S,2R,3E,5S,7S,8S,10R,13S)-2,13-bis(acetyloxy)-7,10-dihydroxy-8,12,15,15-tetramethyl-9-oxotricyclo[9.3.1.14,8]hexadeca-3,11-dien-5-yl ester, (αR,βS)-
- Taxine A
- O~15~-acetyl-4-(acetyloxy)-12-{[3-(dimethylamino)-2-hydroxy-3-phenylpropanoyl]oxy}-7,10-dihydroxy-8-oxo-7,8,9,10,11,12-hexahydro-2,15:9,20-dicycloretinol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Taxine A
CAS:Taxine A is a potent inhibitor of kinases that has been isolated from the Chinese yew tree. It has shown promising results in inhibiting the growth of cancer cells and inducing apoptosis. Taxine A exhibits a unique mechanism of action by binding to a specific site on the kinase, which prevents its activation and subsequent downstream signaling. This analog of linezolid has been shown to have potent anticancer activity against various tumor cell lines, including human breast cancer and lung cancer. Taxine A is also excreted in urine, making it an attractive candidate for non-invasive diagnostic tests for cancer. Its ability to inhibit kinases makes it a potential therapeutic agent for a wide range of cancers.
Formula:C35H47NO10Purity:Min. 95%Molecular weight:641.7 g/molRef: 4Z-T-245001
Discontinued product

