CAS 13610-48-5

(2-oxo-1,3-benzoxazol-3(2H)-yl)acetonitrile

Description:

(2-oxo-1,3-benzoxazol-3(2H)-yl)acetonitrile, identified by its CAS number 13610-48-5, is a chemical compound characterized by its unique structure that includes a benzoxazole moiety and an acetonitrile functional group. This compound typically exhibits properties associated with heterocyclic compounds, such as moderate solubility in polar organic solvents and potential reactivity due to the presence of the nitrile group. The benzoxazole ring contributes to its aromatic character, which can influence its stability and reactivity. Additionally, the presence of the carbonyl group (2-oxo) enhances its potential for hydrogen bonding and may affect its interaction with other chemical species. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing other complex molecules. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₉H₆N₂O₂

InChI: InChI=1/C9H6N2O2/c10-5-6-11-7-3-1-2-4-8(7)13-9(11)12/h1-4H,6H2

SMILES: c1ccc2c(c1)n(CC#N)c(=O)o2

Synonyms:

• 3(2H)-benzoxazoleacetonitrile, 2-oxo-

2-(2-Oxobenzo[d]oxazol-3(2H)-yl)acetonitrile

CAS: 13610-48-5

Formula: C₉H₆N₂O₂

Molecular weight: 174.1561

Ref: IN-DA00AJGG

(2-oxo-1,3-benzoxazol-3(2H)-yl)acetonitrile

CAS: 13610-48-5

Formula: C₉H₆N₂O₂

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 174.159

Ref: 10-F310704