CAS 13610-66-7
:4-(2-OXO-1,3-BENZOXAZOL-3(2H)-YL)BUTANOIC ACID
Description:
4-(2-OXO-1,3-benzoxazol-3(2H)-yl)butanoic acid, with the CAS number 13610-66-7, is a chemical compound that features a benzoxazole moiety, which is a bicyclic structure containing both benzene and oxazole rings. This compound is characterized by its carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the 2-oxo group indicates that it has a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic addition or condensation. The butanoic acid chain provides a hydrophobic character, influencing its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific pathways. Its structural features suggest potential applications in medicinal chemistry, where modifications can lead to enhanced efficacy or selectivity. Overall, the unique combination of functional groups in this compound contributes to its chemical behavior and potential utility in various scientific fields.
Formula:C11H10NO4
InChI:InChI=1/C11H11NO4/c13-10(14)6-3-7-12-8-4-1-2-5-9(8)16-11(12)15/h1-2,4-5H,3,6-7H2,(H,13,14)/p-1
SMILES:c1ccc2c(c1)n(CCCC(=O)[O-])c(=O)o2
Synonyms:- 3(2H)-benzoxazolebutanoic acid, 2-oxo-
- 4-(2-oxo-1,3-benzoxazol-3(2H)-yl)butanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.