CAS 1361003-62-4

2-Methyl-6-propoxybenzoxazole

Description:

2-Methyl-6-propoxybenzoxazole is an organic compound characterized by its benzoxazole structure, which consists of a fused benzene and oxazole ring. This compound features a methyl group at the 2-position and a propoxy group at the 6-position of the benzoxazole ring, contributing to its unique chemical properties. Typically, compounds of this class exhibit moderate to high lipophilicity due to the presence of the aromatic system and alkyl substituents, which can influence their solubility in organic solvents. The presence of the oxazole ring may impart certain biological activities, making such compounds of interest in medicinal chemistry and material science. Additionally, the molecular structure suggests potential applications in fluorescence or as intermediates in organic synthesis. The compound's stability, reactivity, and potential interactions with biological systems would depend on its specific functional groups and overall molecular conformation. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.

Formula: C₁₁H₁₃NO₂

InChI: InChI=1S/C11H13NO2/c1-3-6-13-9-4-5-10-11(7-9)14-8(2)12-10/h4-5,7H,3,6H2,1-2H3

InChI key: InChIKey=HVZXQNNPBSTFTK-UHFFFAOYSA-N

SMILES: CC1=NC=2C(=CC(OCCC)=CC2)O1

Synonyms:

• Benzoxazole, 2-methyl-6-propoxy-
• 2-Methyl-6-propoxybenzoxazole