CAS 1361021-39-7

1-Bromo-4-iodo-2-methoxy-5-nitrobenzene

Description:

1-Bromo-4-iodo-2-methoxy-5-nitrobenzene is an organic compound characterized by its complex aromatic structure, which includes a benzene ring substituted with various functional groups. The presence of both bromine and iodine atoms indicates that it is a polyhalogenated compound, which can influence its reactivity and physical properties. The methoxy group (-OCH3) contributes to its electron-donating characteristics, while the nitro group (-NO2) is a strong electron-withdrawing group, affecting the compound's overall electronic distribution and reactivity. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic nature and the presence of polar functional groups. Its unique combination of substituents may make it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions, and it may serve as an intermediate in the synthesis of more complex molecules. Additionally, the presence of halogens and a nitro group may impart biological activity, making it of interest in medicinal chemistry and materials science.

Formula: C₇H₅BrINO₃

InChI: InChI=1S/C7H5BrINO3/c1-13-7-3-5(9)6(10(11)12)2-4(7)8/h2-3H,1H3

InChI key: InChIKey=LIQQFDPRYUYNMP-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C(I)C=C(OC)C(Br)=C1

Synonyms:

• 1-Bromo-4-iodo-2-methoxy-5-nitrobenzene
• 1-Bromo-4-iodo-2-methoxy-5-nitrobenzen
• Benzene, 1-bromo-4-iodo-2-methoxy-5-nitro-

2-Bromo-5-iodo-4-nitroanisole

CAS: 1361021-39-7

2-Bromo-5-iodo-4-nitroanisole

Formula: C₇H₅BrINO₃

Purity: 95%

Color and Shape: light orange to yellow crystalline solid

Molecular weight: 357.93g/mol

Ref: 54-OR400544