CAS 136103-77-0

2-thiophen-2-yl-1H-imidazole

Description:

2-Thiophen-2-yl-1H-imidazole is a heterocyclic organic compound characterized by the presence of both an imidazole ring and a thiophene moiety. The imidazole ring is a five-membered aromatic structure containing two nitrogen atoms, which contributes to the compound's basicity and potential for coordination with metal ions. The thiophene ring, a five-membered ring containing a sulfur atom, imparts unique electronic properties and enhances the compound's aromatic character. This compound is typically a solid at room temperature and may exhibit solubility in polar organic solvents. Its structure suggests potential applications in pharmaceuticals, agrochemicals, and materials science due to the presence of both nitrogen and sulfur, which can participate in various chemical reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. The presence of the thiophene group can also influence the compound's electronic properties, potentially making it useful in organic electronics or as a dye. Overall, 2-thiophen-2-yl-1H-imidazole is a versatile compound with significant potential in various fields of chemistry.

Formula: C₇H₆N₂S

InChI: InChI=1/C7H6N2S/c1-2-6(10-5-1)7-8-3-4-9-7/h1-5H,(H,8,9)

SMILES: c1cc(c2[nH]ccn2)sc1

Synonyms:

• 1H-imidazole, 2-(2-thienyl)-
• 2-(2-Thienyl)-1H-imidazole
• 2-(Thiophen-2-yl)imidazole

2-(2-Thienyl)-1H-imidazole

CAS: 136103-77-0

2-(2-Thienyl)-1H-imidazole is a virus inhibitor that blocks the influenza virus from entering cells. It binds to the influenza virus and prevents it from penetrating into the cell membrane. The antiviral activity of 2-(2-thienyl)-1H-imidazole is due to its ability to inhibit serine proteases, which are proteins that are involved in viral replication. This drug can also be used as a monoclonal antibody against hepatitis viruses. 2-(2-Thienyl)-1H-imidazole has been shown to inhibit dna replication, but not protein synthesis or transcription, in cells infected with HIV. In addition, 2-(2-thienyl)-1H-imidazole inhibits low light induced activation of dna replication in bacteria and fungi.

Formula: C₇H₆N₂S

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 150.2 g/mol

Ref: 3D-FT163191

2-THIOPHEN-2-YL-1H-IMIDAZOLE

CAS: 136103-77-0

Formula: C₇H₆N₂S

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 150.2

Ref: 10-F304053