CAS 136105-89-0
:(deamino-cys1
Description:
The chemical substance known as deamino-cys1, with the CAS number 136105-89-0, is a modified peptide that is derived from cysteine. It is characterized by the absence of the amino group typically found in cysteine, which alters its reactivity and biological properties. Deamino-cys1 is often utilized in biochemical research and pharmaceutical applications due to its potential role in peptide synthesis and as a building block for more complex molecules. The modification can influence its solubility, stability, and interaction with other biomolecules, making it a valuable compound in the study of protein structure and function. Additionally, its unique properties may allow for specific applications in drug development, particularly in the design of therapeutics that target cysteine-rich proteins or pathways. As with many peptides, its behavior in biological systems can be influenced by factors such as pH, temperature, and the presence of other ions or molecules.
Formula:C45H63N15O11S2
InChI:InChI=1/C45H63N15O11S2/c46-34(61)13-12-28-39(66)58-31(21-35(47)62)42(69)59-32(44(71)60-17-6-11-33(60)43(70)56-27(10-5-16-52-45(49)50)38(65)53-23-36(48)63)24-73-72-18-14-37(64)54-29(20-26-9-4-15-51-22-26)40(67)57-30(41(68)55-28)19-25-7-2-1-3-8-25/h1-4,7-9,15,22,27-33H,5-6,10-14,16-21,23-24H2,(H2,46,61)(H2,47,62)(H2,48,63)(H,53,65)(H,54,64)(H,55,68)(H,56,70)(H,57,67)(H,58,66)(H,59,69)(H4,49,50,52)
SMILES:c1ccc(cc1)CC1C(=NC(CCC(=N)O)C(=NC(CC(=N)O)C(=NC(CSSCCC(=NC(Cc2cccnc2)C(=N1)O)O)C(=O)N1CCCC1C(=NC(CCCNC(=N)N)C(=NCC(=N)O)O)O)O)O)O
Synonyms:- Argipressin, 1-deamino-3-(3'-pyridyl)-ala(2)-
- 1-Deamino-3-(3'-pyridyl)-2-ala-argipressin
- Argipressin, 1-deamino-3-(3'-pyridyl)alanine(2)-
- d(D-3-Pal)VP
- 1-{[7-(2-amino-2-oxoethyl)-10-(3-amino-3-oxopropyl)-13-benzyl-6,9,12,15,18-pentaoxo-16-(pyridin-3-ylmethyl)-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}prolyl-N~5~-(diaminomethylidene)ornithylglycinamide
- 3-Mercaptopropionyl-Beta-3-Pyridyl-D-Ala-Phe-Gln-Asn-Cys-Pro-Arg-Gly-Nh2
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Desamino(D-3-(3′-pyridyl)-Ala2,Arg8)-Vasopressin
CAS:Desamino(D-3-(3′-pyridyl)-Ala2,Arg8)-Vasopressin, a synthetic analog of vasopressin (AVP), acts as a weak agonist at the antidiuretic receptor but is a potentFormula:C45H63N15O11S2Color and Shape:SolidMolecular weight:1054.21(Deamino-Cys1,b-(3-pyridyl)-D-Ala2,Arg8)-Vasopressin trifluoroacetate salt
CAS:<p>DDAVP is an analogue of vasopressin, which belongs to the class of inositol phosphates. It is a potent agonist for the V1 receptor and has a higher affinity for this receptor than vasopressin. DDAVP also has antagonist properties at the V2 receptor. The biological activity of DDAVP is mediated by its ability to increase phospholipase A2 activity and cause the release of arachidonic acid from membrane phospholipids. This activation causes an increase in prostaglandin synthesis, leading to increased vascular permeability and hypotension. DDAVP may also have antidiuretic effects due to its antagonism of oxytocin receptors.</p>Formula:C45H63N15O11S2Purity:Min. 95%Molecular weight:1,054.21 g/mol

