
CAS 136105-91-4
:N-Hexylcycloheptanamine
Description:
N-Hexylcycloheptanamine, identified by its CAS number 136105-91-4, is an organic compound characterized by its unique structure, which consists of a cycloheptane ring substituted with a hexyl group and an amine functional group. This compound is typically a colorless to pale yellow liquid, exhibiting a moderate to high boiling point and a relatively low vapor pressure, indicating its potential for stability under standard conditions. N-Hexylcycloheptanamine is likely to be soluble in organic solvents due to its hydrophobic hexyl chain, while its amine group may impart some degree of polarity. The presence of the amine functional group suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other chemical species. This compound may find applications in various fields, including pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C13H27N
InChI:InChI=1S/C13H27N/c1-2-3-4-9-12-14-13-10-7-5-6-8-11-13/h13-14H,2-12H2,1H3
InChI key:InChIKey=HLLJXDWRUNUUSP-UHFFFAOYSA-N
SMILES:N(CCCCCC)C1CCCCCC1
Synonyms:- Cycloheptanamine, N-hexyl-
- N-Hexylcycloheptanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.