CAS 1361111-62-7

1-[(1-Acetyl-2-pyrrolidinyl)carbonyl]-3-azetidinecarboxylic acid

Description:

1-[(1-Acetyl-2-pyrrolidinyl)carbonyl]-3-azetidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and an azetidine ring, both of which contribute to its potential biological activity. The presence of an acetyl group and a carboxylic acid functional group suggests that this compound may exhibit both polar and non-polar characteristics, influencing its solubility and reactivity. The molecular structure indicates that it may participate in various chemical reactions, such as acylation or esterification, due to the reactive functional groups. Additionally, the compound's stereochemistry could play a significant role in its interaction with biological targets, making it of interest in medicinal chemistry. Its specific applications and biological properties would depend on further studies, including pharmacological evaluations and toxicity assessments. Overall, this compound represents a class of molecules that may have potential therapeutic applications, warranting further investigation into its chemical behavior and biological effects.

Formula: C₁₁H₁₆N₂O₄

InChI: InChI=1S/C11H16N2O4/c1-7(14)13-4-2-3-9(13)10(15)12-5-8(6-12)11(16)17/h8-9H,2-6H2,1H3,(H,16,17)

InChI key: InChIKey=ZEYOHMVXHYBKIL-UHFFFAOYSA-N

SMILES: C(=O)(C1N(C(C)=O)CCC1)N2CC(C(O)=O)C2

Synonyms:

• 3-Azetidinecarboxylic acid, 1-[(1-acetyl-2-pyrrolidinyl)carbonyl]-
• 1-[(1-Acetyl-2-pyrrolidinyl)carbonyl]-3-azetidinecarboxylic acid