CAS 1361112-27-7

Piperidine, 3-[4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl]-, hydrochloride (1:2)

Description:

Piperidine, 3-[4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a triazole moiety, specifically a 4H-1,2,4-triazole, which is a five-membered ring containing three nitrogen atoms, contributing to its biological activity. The presence of a methoxyethyl substituent enhances its solubility and potential interactions with biological targets. As a hydrochloride salt, it is typically more stable and soluble in water, facilitating its use in pharmaceutical applications. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions and efficacy would depend on the structural features and the functional groups present, which can influence its binding affinity and activity in biological systems. Overall, this compound represents a class of heterocyclic compounds that are often explored for their therapeutic potential.

Formula: C₁₀H₁₈N₄O·2ClH

InChI: InChI=1S/C10H18N4O.2ClH/c1-15-6-5-14-8-12-13-10(14)9-3-2-4-11-7-9;;/h8-9,11H,2-7H2,1H3;2*1H

InChI key: InChIKey=RDMXZFRPTKZYAE-UHFFFAOYSA-N

SMILES: C(COC)N1C(=NN=C1)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-[4-(2-methoxyethyl)-4H-1,2,4-triazol-3-yl]-, hydrochloride (1:2)