
CAS 1361113-53-2
:Pyrimidine, 5-methyl-4-(3-piperidinyl)-, hydrochloride (1:2)
Description:
Pyrimidine, 5-methyl-4-(3-piperidinyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a methyl group at the 5-position and a piperidine moiety at the 4-position contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. This compound may exhibit biological activity, potentially acting as a ligand or modulator in biochemical pathways, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, which can be explored for therapeutic purposes. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications.
Formula:C10H15N3·2ClH
InChI:InChI=1S/C10H15N3.2ClH/c1-8-5-12-7-13-10(8)9-3-2-4-11-6-9;;/h5,7,9,11H,2-4,6H2,1H3;2*1H
InChI key:InChIKey=GDKGIDFSDXXPEU-UHFFFAOYSA-N
SMILES:CC=1C(C2CCCNC2)=NC=NC1.Cl
Synonyms:- Pyrimidine, 5-methyl-4-(3-piperidinyl)-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.