CAS 1361113-65-6

2-(Dimethylamino)-N-[2-(2-pyrrolidinyl)ethyl]acetamide

Description:

2-(Dimethylamino)-N-[2-(2-pyrrolidinyl)ethyl]acetamide, identified by its CAS number 1361113-65-6, is a chemical compound characterized by its amide functional group and the presence of both dimethylamino and pyrrolidine moieties. This compound typically exhibits properties associated with amides, such as moderate polarity and the ability to engage in hydrogen bonding, which can influence its solubility in various solvents. The dimethylamino group contributes to its basicity, while the pyrrolidine ring may impart cyclic characteristics that affect its conformational flexibility and steric interactions. This compound may be of interest in medicinal chemistry due to its potential biological activity, particularly in relation to neurotransmitter systems or as a pharmacophore in drug design. Its structural features suggest it could interact with various biological targets, making it a candidate for further investigation in therapeutic applications. However, specific safety and handling information should be consulted from reliable sources, as with any chemical substance.

Formula: C₁₀H₂₁N₃O

InChI: InChI=1S/C10H21N3O/c1-13(2)8-10(14)12-7-5-9-4-3-6-11-9/h9,11H,3-8H2,1-2H3,(H,12,14)

InChI key: InChIKey=MPITVBBQNXKFQS-UHFFFAOYSA-N

SMILES: C(CNC(CN(C)C)=O)C1CCCN1

Synonyms:

• Acetamide, 2-(dimethylamino)-N-[2-(2-pyrrolidinyl)ethyl]-
• 2-(Dimethylamino)-N-[2-(2-pyrrolidinyl)ethyl]acetamide