
CAS 1361113-66-7
:4-Piperidinecarboxamide, N,N-dimethyl-4-[3-(4-pyridinyl)propyl]-, hydrochloride (1:2)
Description:
4-Piperidinecarboxamide, N,N-dimethyl-4-[3-(4-pyridinyl)propyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine and pyridine moieties, which contribute to its potential biological activity. The presence of the piperidine ring provides a cyclic structure that can influence the compound's pharmacological properties, while the dimethylamino group enhances its solubility and reactivity. The hydrochloride salt form indicates that the compound is a hydrochloride, which typically improves stability and solubility in aqueous solutions. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions, given the structural features associated with neurotransmitter modulation. Its molecular structure suggests potential interactions with various biological targets, making it a candidate for further research in drug development. However, specific biological activities, toxicity, and therapeutic applications would require detailed experimental studies to elucidate its full profile.
Formula:C16H25N3O·2ClH
InChI:InChI=1S/C16H25N3O.2ClH/c1-19(2)15(20)16(8-12-18-13-9-16)7-3-4-14-5-10-17-11-6-14;;/h5-6,10-11,18H,3-4,7-9,12-13H2,1-2H3;2*1H
InChI key:InChIKey=RRVFXMLLQORGLY-UHFFFAOYSA-N
SMILES:C(CCC=1C=CN=CC1)C2(C(N(C)C)=O)CCNCC2.Cl
Synonyms:- 4-Piperidinecarboxamide, N,N-dimethyl-4-[3-(4-pyridinyl)propyl]-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.