CymitQuimica logo

CAS 1361115-07-2

:

1-[3-[2-(Dimethylamino)-5-iodo-4-pyrimidinyl]-1-piperidinyl]ethanone

Description:
1-[3-[2-(Dimethylamino)-5-iodo-4-pyrimidinyl]-1-piperidinyl]ethanone, identified by its CAS number 1361115-07-2, is a chemical compound that features a complex structure incorporating a pyrimidine ring, a piperidine moiety, and a ketone functional group. This compound is characterized by the presence of a dimethylamino group, which enhances its basicity and potential for forming hydrogen bonds. The iodine substituent on the pyrimidine ring may influence its reactivity and biological activity, potentially making it a candidate for pharmaceutical applications. The piperidine ring contributes to the compound's overall stability and may affect its lipophilicity, impacting its ability to permeate biological membranes. Additionally, the presence of the ethanone group suggests potential reactivity in various chemical reactions, including nucleophilic attacks. Overall, this compound's unique structural features may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development.
Formula:C13H19IN4O
InChI:InChI=1S/C13H19IN4O/c1-9(19)18-6-4-5-10(8-18)12-11(14)7-15-13(16-12)17(2)3/h7,10H,4-6,8H2,1-3H3
InChI key:InChIKey=DXKSKAJMWXFOJD-UHFFFAOYSA-N
SMILES:IC=1C(C2CN(C(C)=O)CCC2)=NC(N(C)C)=NC1
Synonyms:
  • 1-[3-[2-(Dimethylamino)-5-iodo-4-pyrimidinyl]-1-piperidinyl]ethanone
  • Ethanone, 1-[3-[2-(dimethylamino)-5-iodo-4-pyrimidinyl]-1-piperidinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.