CAS 1361115-82-3

Formic acid, compd. with 2-chloro-4-(1-methyl-4-piperidinyl)pyridine (1:1)

Description:

Formic acid, compd. with 2-chloro-4-(1-methyl-4-piperidinyl)pyridine (1:1), identified by the CAS number 1361115-82-3, is a chemical compound that combines formic acid, a simple carboxylic acid, with a specific pyridine derivative. Formic acid is known for its strong acidity and ability to act as a reducing agent, while the pyridine derivative contributes to the compound's potential biological activity, particularly in pharmaceutical applications. This compound may exhibit characteristics such as solubility in polar solvents, moderate stability under standard conditions, and potential reactivity due to the presence of both acidic and basic functional groups. The combination of these components suggests that it may have applications in medicinal chemistry, possibly as an intermediate in the synthesis of more complex molecules or as a bioactive agent. However, specific properties such as melting point, boiling point, and spectral data would require empirical measurement or detailed literature references for precise characterization.

Formula: C₁₁H₁₅ClN₂·CH₂O₂

InChI: InChI=1S/C11H15ClN2.CH2O2/c1-14-6-3-9(4-7-14)10-2-5-13-11(12)8-10;2-1-3/h2,5,8-9H,3-4,6-7H2,1H3;1H,(H,2,3)

InChI key: InChIKey=NXHUXIJXSPENKW-UHFFFAOYSA-N

SMILES: ClC1=CC(=CC=N1)C2CCN(C)CC2.C(O)=O

Synonyms:

• Formic acid, compd. with 2-chloro-4-(1-methyl-4-piperidinyl)pyridine (1:1)