CymitQuimica logo

CAS 1361116-20-2

:

Pyridine, 5-methyl-2-(4-piperidinylmethyl)-, hydrochloride (1:2)

Description:
Pyridine, 5-methyl-2-(4-piperidinylmethyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine and piperidine moieties, which contribute to its basicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the methyl group and the piperidinylmethyl substituent suggests that this compound may exhibit specific interactions with biological targets, potentially influencing its pharmacological properties. Its structure indicates that it may participate in hydrogen bonding and other interactions due to the nitrogen atoms in the rings, which can affect its reactivity and stability. Additionally, the compound may be of interest in medicinal chemistry for its potential use in drug development, particularly in the context of central nervous system disorders, given the piperidine's known activity in this area. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C12H18N2·2ClH
InChI:InChI=1S/C12H18N2.2ClH/c1-10-2-3-12(14-9-10)8-11-4-6-13-7-5-11;;/h2-3,9,11,13H,4-8H2,1H3;2*1H
InChI key:InChIKey=KWANAVQGADQPTN-UHFFFAOYSA-N
SMILES:C(C1=CC=C(C)C=N1)C2CCNCC2.Cl
Synonyms:
  • Pyridine, 5-methyl-2-(4-piperidinylmethyl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.