CAS 1361116-43-9

4-Piperidinecarboxamide, N-cyclopentyl-4-methyl-, hydrochloride (1:1)

Description:

4-Piperidinecarboxamide, N-cyclopentyl-4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a carboxamide functional group indicates that it has potential for hydrogen bonding, influencing its solubility and reactivity. The cyclopentyl and methyl substituents on the piperidine ring contribute to its steric and electronic properties, potentially affecting its biological activity and interaction with receptors. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would be determined through experimental methods. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance.

Formula: C₁₂H₂₂N₂O·ClH

InChI: InChI=1S/C12H22N2O.ClH/c1-12(6-8-13-9-7-12)11(15)14-10-4-2-3-5-10;/h10,13H,2-9H2,1H3,(H,14,15);1H

InChI key: InChIKey=UIMHHCLOENSLRQ-UHFFFAOYSA-N

SMILES: C(NC1CCCC1)(=O)C2(C)CCNCC2.Cl

Synonyms:

• 4-Piperidinecarboxamide, N-cyclopentyl-4-methyl-, hydrochloride (1:1)