
CAS 1361118-52-6
:N-[2-Methyl-6-(2-pyrrolidinyl)-4-pyridinyl]-2-pyrazinamine
Description:
N-[2-Methyl-6-(2-pyrrolidinyl)-4-pyridinyl]-2-pyrazinamine, identified by its CAS number 1361118-52-6, is a chemical compound that belongs to the class of pyrazinamines. This substance features a complex molecular structure characterized by multiple heterocyclic rings, specifically incorporating pyridine and pyrazine moieties. The presence of a pyrrolidine group contributes to its potential biological activity, which may include interactions with various receptors or enzymes. The compound is likely to exhibit moderate to high solubility in polar solvents due to its nitrogen-containing functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or other disorders. As with many organic compounds, its stability, reactivity, and biological properties would depend on specific environmental conditions and the presence of other chemical entities. Safety data and handling precautions should be consulted when working with this compound, as with any chemical substance.
Formula:C14H17N5
InChI:InChI=1S/C14H17N5/c1-10-7-11(19-14-9-15-5-6-17-14)8-13(18-10)12-3-2-4-16-12/h5-9,12,16H,2-4H2,1H3,(H,17,18,19)
InChI key:InChIKey=WYZPLCAFWAWGJX-UHFFFAOYSA-N
SMILES:N(C=1C=C(N=C(C)C1)C2CCCN2)C=3C=NC=CN3
Synonyms:- N-[2-Methyl-6-(2-pyrrolidinyl)-4-pyridinyl]-2-pyrazinamine
- 2-Pyrazinamine, N-[2-methyl-6-(2-pyrrolidinyl)-4-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.