CymitQuimica logo

CAS 1361118-67-3

:

Piperidine, 2-(4-methyl-4H-1,2,4-triazol-3-yl)-, hydrochloride (1:2)

Description:
Piperidine, 2-(4-methyl-4H-1,2,4-triazol-3-yl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The presence of the 4-methyl-4H-1,2,4-triazole moiety introduces additional nitrogen atoms into the structure, contributing to its potential biological activity and pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. This compound may exhibit properties such as antimicrobial, antifungal, or anti-inflammatory activities, although specific biological effects would depend on further studies. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C8H14N4·2ClH
InChI:InChI=1S/C8H14N4.2ClH/c1-12-6-10-11-8(12)7-4-2-3-5-9-7;;/h6-7,9H,2-5H2,1H3;2*1H
InChI key:InChIKey=BXADMYPMQHOHAR-UHFFFAOYSA-N
SMILES:CN1C(=NN=C1)C2CCCCN2.Cl
Synonyms:
  • Piperidine, 2-(4-methyl-4H-1,2,4-triazol-3-yl)-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.