
CAS 1361118-71-9
:Pyrimidine, 4-methyl-2-(2-pyrrolidinyl)-, hydrochloride (1:1)
Description:
Pyrimidine, 4-methyl-2-(2-pyrrolidinyl)-, hydrochloride (1:1), with the CAS number 1361118-71-9, is a chemical compound that belongs to the class of pyrimidines, which are heterocyclic aromatic organic compounds containing nitrogen atoms in the ring structure. This specific compound features a pyrimidine ring substituted with a methyl group at the 4-position and a pyrrolidine moiety at the 2-position, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and facilitates its use in various applications, including pharmaceuticals and research. The presence of the pyrrolidine group may impart specific biological activities, making it of interest in medicinal chemistry. The compound's characteristics, such as melting point, solubility, and reactivity, can vary based on its formulation and purity. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.
Formula:C9H13N3·ClH
InChI:InChI=1S/C9H13N3.ClH/c1-7-4-6-11-9(12-7)8-3-2-5-10-8;/h4,6,8,10H,2-3,5H2,1H3;1H
InChI key:InChIKey=DQOJUYZBOLPGHC-UHFFFAOYSA-N
SMILES:CC1=NC(=NC=C1)C2CCCN2.Cl
Synonyms:- Pyrimidine, 4-methyl-2-(2-pyrrolidinyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.