CAS 136117-70-9

Imidazo[1,2-a]pyridine-8-carbonitrile

Description:

Imidazo[1,2-a]pyridine-8-carbonitrile is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a carbonitrile group at the 8-position enhances its reactivity and polarity, making it a valuable intermediate in organic synthesis and medicinal chemistry. This compound typically exhibits a solid-state form and is known for its potential biological activities, including antimicrobial and anticancer properties. Its structure allows for various functionalizations, which can lead to the development of novel pharmaceuticals. Additionally, imidazo[1,2-a]pyridine derivatives are often explored for their role in targeting specific biological pathways, making them of interest in drug discovery. The compound's stability and solubility can vary depending on the substituents attached to the core structure, influencing its application in various chemical contexts. Overall, imidazo[1,2-a]pyridine-8-carbonitrile is a significant compound in the field of organic chemistry and pharmacology.

Formula: C₈H₅N₃

InChI: InChI=1S/C8H5N3/c9-6-7-2-1-4-11-5-3-10-8(7)11/h1-5H

InChI key: InChIKey=MYTKOOVOBCDRPN-UHFFFAOYSA-N

SMILES: C(#N)C=1C=2N(C=CN2)C=CC1

Synonyms:

• Imidazo[1,2-a]pyridine-8-carbonitrile

Imidazo[1,2-a]pyridine-8-carbonitrile

CAS: 136117-70-9

Formula: C₈H₅N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 143.1454

Ref: IN-DA009W7D

Imidazo[1,2-a]pyridine-8-carbonitrile

CAS: 136117-70-9

Imidazo[1,2-a]pyridine-8-carbonitrile

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 143.15g/mol

Ref: 54-OR111132

Imidazo[1,2-a]pyridine-8-carbonitrile

CAS: 136117-70-9

Formula: C₈H₅N₃

Purity: 95.0%

Molecular weight: 143.149

Ref: 10-F435984

Imidazo[1,2-a]pyridine-8-carbonitrile

CAS: 136117-70-9

Imidazo[1,2-a]pyridine-8-carbonitrile is an anthranilic compound that has been shown to induce cancer cell death by triggering apoptosis. Imidazo[1,2-a]pyridine-8-carbonitrile also has a molecular weight of 254.33 and a melting point of 222°C. This drug disrupts the mitochondrial membrane potential and causes the release of cytochrome c and other proteins into the cytosol. Imidazo[1,2-a]pyridine-8-carbonitrile has been shown to inhibit the growth of human colorectal cancer cells in vitro and in vivo. It also inhibits mkn-45, which is a protein that regulates cell proliferation and survival.

Formula: C₈H₅N₃

Purity: Min. 95%

Molecular weight: 143.14 g/mol

Ref: 3D-LFA11770