CAS 136117-72-1

6-BROMO-2-CHLOROMETHYL-IMIDAZO[1,2-A]PYRIDINE

Description:

6-Bromo-2-chloromethyl-imidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by its imidazo and pyridine ring structures, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents enhances its reactivity, making it a valuable intermediate in organic synthesis and medicinal chemistry. This compound typically exhibits moderate to high solubility in polar organic solvents, and its structure suggests potential biological activity, which may include antimicrobial or anticancer properties. The imidazo[1,2-a]pyridine framework is known for its ability to interact with biological targets, making derivatives of this compound of interest in drug discovery. Additionally, the presence of halogen atoms can influence the compound's electronic properties, stability, and lipophilicity, which are crucial for its pharmacokinetic profile. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks. Overall, 6-bromo-2-chloromethyl-imidazo[1,2-a]pyridine represents a significant compound in the field of synthetic and medicinal chemistry.

Formula: C₈H₆BrClN₂

InChI: InChI=1/C8H6BrClN2/c9-6-1-2-8-11-7(3-10)5-12(8)4-6/h1-2,4-5H,3H2

SMILES: c1cc2nc(CCl)cn2cc1Br

Synonyms:

• Imidazo[1,2-a]pyridine, 6-bromo-2-(chloromethyl)-

6-Bromo-2-chloromethylimidazo[1,2-a]pyridine

CAS: 136117-72-1

Formula: C₈H₆BrClN₂

Molecular weight: 245.5036

Ref: IN-DA0071CC

6-Bromo-2-(chloromethyl)imidazo[1,2-a]pyridine

CAS: 136117-72-1

6-Bromo-2-(chloromethyl)imidazo[1,2-a]pyridine

Purity: 95%

Molecular weight: 245.50g/mol

Ref: 54-OR60134