CAS 1361233-94-4
:B-(3-Methyl-1H-indol-6-yl)boronic acid
Description:
B-(3-Methyl-1H-indol-6-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a 3-methyl-1H-indole moiety. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The indole structure contributes to its potential biological activity, as indoles are known for their presence in many natural products and pharmaceuticals. The compound is likely to be a solid at room temperature and may have moderate solubility in polar solvents due to the presence of the boronic acid group. Its reactivity can be influenced by the pH of the environment, as boronic acids can exist in different forms depending on protonation. Overall, B-(3-Methyl-1H-indol-6-yl)boronic acid is a versatile compound with potential applications in drug development and materials science.
Formula:C9H10BNO2
InChI:InChI=1S/C9H10BNO2/c1-6-5-11-9-4-7(10(12)13)2-3-8(6)9/h2-5,11-13H,1H3
InChI key:InChIKey=VCGNVVDDGOIIMG-UHFFFAOYSA-N
SMILES:CC=1C=2C(=CC(B(O)O)=CC2)NC1
Synonyms:- Boronic acid, B-(3-methyl-1H-indol-6-yl)-
- B-(3-Methyl-1H-indol-6-yl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
