CAS 13613-65-5
:(R)-(-)-sodium- 3-hydroxybutyrate
Description:
(R)-(-)-sodium 3-hydroxybutyrate, with the CAS number 13613-65-5, is a sodium salt of 3-hydroxybutyric acid, a compound that plays a significant role in metabolic processes, particularly in the context of ketogenesis. This substance is characterized by its chiral nature, existing as the (R)-enantiomer, which is biologically active and often associated with various physiological effects. It is typically a white to off-white crystalline powder that is soluble in water, making it suitable for various applications in biochemistry and nutrition. The compound is known for its potential use in dietary supplements, particularly in ketogenic diets, where it may serve as a source of energy and support metabolic health. Additionally, it has been studied for its potential therapeutic effects in conditions such as metabolic disorders and neurological diseases. Its stability and solubility in aqueous solutions make it a versatile compound in both research and clinical settings.
Formula:C4H7NaO3
InChI:InChI=1/C4H8O3.Na/c1-3(5)2-4(6)7;/h3,5H,2H2,1H3,(H,6,7);/q;+1/p-1/t3-;/m1./s1
SMILES:CC(CC(=O)O)O.[Na]
Synonyms:- R-(-)-3-Hydroxybutyric acid sodium salt
- sodium (3R)-3-hydroxybutanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
(R)-(-)-Sodium 3-hydroxybutyrate
CAS:Formula:C4H7NaO3Purity:97%Color and Shape:SolidMolecular weight:126.0863Ref: IN-DA0032DL
1gTo inquire5g20.00€10g25.00€1kg276.00€25g28.00€50g53.00€100g63.00€250g120.00€500g163.00€(R)-(-)-3-Hydroxybutyric Acid, Sodium Salt
CAS:(R)-(-)-3-Hydroxybutyric Acid, Sodium SaltPurity:98%Molecular weight:126.09g/mol(R)-3-Hydroxybutanoic acid sodium
CAS:(R)-3-Hydroxybutanoic acid sodiumPurity:≥98%Molecular weight:126.09g/mol(R)-3-Hydroxybutanoic acid sodium
CAS:(R)-3-Hydroxybutanoic acid sodium ((R)-3-Hydroxybutyric acid) is a chiral precursor for the synthesis of biodegradable PHB and its copolyesters.Formula:C4H7NaO3Purity:99.5%Color and Shape:SoildMolecular weight:126.09(R)-3-Hydroxybutyric acid sodium
CAS:Chiral intermediate in the biosynthesis and metabolism of fatty acids
Formula:C4H8O3•NaColor and Shape:PowderMolecular weight:127.09 g/mol(R)-(-)-3-Hydroxybutyric Acid Sodium Salt
CAS:Controlled ProductStability Hygroscopic
Applications Optically active 3-hydroxybutyric acids are key intermediates of the biosynthesis and metabolism of fatty acids and exist widely in biological systems.
References Freeman, J., et al.: Pediatrics, 102, 1358 (1998), Thio, L., et al.: Neurology, 54, 325 (2000), Rho, J., et al.: Epilepsia, 43, 358 (2002),Formula:C4H7O3·NaColor and Shape:NeatMolecular weight:126.09Sodium (R)-3-hydroxybutanoate
CAS:Formula:C4H7NaO3Purity:97%Color and Shape:SolidMolecular weight:126.087





