CAS 1361386-46-0

Methyl 3-(bromomethyl)-5-(1,1-dimethylethyl)-2-thiophenecarboxylate

Description:

Methyl 3-(bromomethyl)-5-(1,1-dimethylethyl)-2-thiophenecarboxylate is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features a bromomethyl group, which enhances its reactivity, and a tert-butyl group, contributing to its steric bulk and potentially influencing its solubility and reactivity. The presence of the methyl ester functional group indicates that it can undergo hydrolysis to form the corresponding carboxylic acid. The compound's structure suggests it may exhibit interesting chemical properties, such as potential applications in organic synthesis or as an intermediate in the production of more complex molecules. Additionally, the bromine atom can serve as a site for further substitution reactions, making it a valuable building block in medicinal chemistry and materials science. Overall, this compound's unique structural features and functional groups make it a subject of interest for various chemical applications.

Formula: C₁₁H₁₅BrO₂S

InChI: InChI=1S/C11H15BrO2S/c1-11(2,3)8-5-7(6-12)9(15-8)10(13)14-4/h5H,6H2,1-4H3

InChI key: InChIKey=KDLLDSDZHKCIKW-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(CBr)C=C(C(C)(C)C)S1

Synonyms:

• 2-Thiophenecarboxylic acid, 3-(bromomethyl)-5-(1,1-dimethylethyl)-, methyl ester
• Methyl 3-(Bromomethyl)-5-tert-butylthiophene-2-carboxylate
• Methyl 3-(bromomethyl)-5-(1,1-dimethylethyl)-2-thiophenecarboxylate