CAS 136146-84-4

2-Fluoro-5-nitro-N-(phenylmethyl)benzamide

Description:

2-Fluoro-5-nitro-N-(phenylmethyl)benzamide is an organic compound characterized by its functional groups and structural features. It contains a benzamide moiety, which is a derivative of benzoic acid where the carboxylic acid group is replaced by an amide group. The presence of a fluoro group at the 2-position and a nitro group at the 5-position on the benzene ring contributes to its reactivity and potential applications in pharmaceuticals or agrochemicals. The phenylmethyl substituent (also known as a benzyl group) attached to the nitrogen atom enhances its lipophilicity, which can influence its biological activity and solubility. This compound may exhibit interesting properties such as antimicrobial or anti-inflammatory activities, making it a subject of interest in medicinal chemistry. Its molecular structure and substituents suggest that it could participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic attack, depending on the reaction conditions. Safety and handling precautions should be observed due to the presence of the nitro group, which can be sensitive and potentially hazardous.

Formula: C₁₄H₁₁FN₂O₃

InChI: InChI=1S/C14H11FN2O3/c15-13-7-6-11(17(19)20)8-12(13)14(18)16-9-10-4-2-1-3-5-10/h1-8H,9H2,(H,16,18)

InChI key: InChIKey=LRGUKTYUKQCOFX-UHFFFAOYSA-N

SMILES: C(NCC1=CC=CC=C1)(=O)C2=CC(N(=O)=O)=CC=C2F

Synonyms:

• Benzamide, 2-fluoro-5-nitro-N-(phenylmethyl)-
• 2-Fluoro-5-nitro-N-(phenylmethyl)benzamide